About 3,4-difluoroaniline;4-(2-piperazin-1-ylethyl)morpholine
3,4-difluoroaniline;4-(2-piperazin-1-ylethyl)morpholine (PubChem CID 158877915) has the molecular formula C16H26F2N4O
and a molecular weight of 328.41 g/mol. Its IUPAC name is 3,4-difluoroaniline;4-(2-piperazin-1-ylethyl)morpholine.
Molecular Properties
| Compound Name | 3,4-difluoroaniline;4-(2-piperazin-1-ylethyl)morpholine |
| PubChem CID | 158877915 |
| Molecular Formula | C16H26F2N4O |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 3,4-difluoroaniline;4-(2-piperazin-1-ylethyl)morpholine |
| SMILES | C1CN(CCN2CCOCC2)CCN1.Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H21N3O.C6H5F2N/c1-3-12(4-2-11-1)5-6-13-7-9-14-10-8-13;7-5-2-1-4(9)3-6(5)8/h11H,1-10H2;1-3H,9H2 |
| InChIKey | JCQZMLIZBABOSO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-difluoroaniline;4-(2-piperazin-1-ylethyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-difluoroaniline;4-(2-piperazin-1-ylethyl)morpholine?
The IUPAC name of 3,4-difluoroaniline;4-(2-piperazin-1-ylethyl)morpholine (CID 158877915) is 3,4-difluoroaniline;4-(2-piperazin-1-ylethyl)morpholine.
What is the SMILES notation for 3,4-difluoroaniline;4-(2-piperazin-1-ylethyl)morpholine?
The canonical SMILES for 3,4-difluoroaniline;4-(2-piperazin-1-ylethyl)morpholine is C1CN(CCN2CCOCC2)CCN1.Nc1ccc(F)c(F)c1.
What is the InChIKey of 3,4-difluoroaniline;4-(2-piperazin-1-ylethyl)morpholine?
The InChIKey is JCQZMLIZBABOSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O.C6H5F2N/c1-3-12(4-2-11-1)5-6-13-7-9-14-10-8-13;7-5-2-1-4(9)3-6(5)8/h11H,1-10H2;1-3H,9H2.
What are the key properties of 3,4-difluoroaniline;4-(2-piperazin-1-ylethyl)morpholine?
3,4-difluoroaniline;4-(2-piperazin-1-ylethyl)morpholine has a molecular weight of 328.41 g/mol, XLogP of 0.77, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-difluoroaniline;4-(2-piperazin-1-ylethyl)morpholine is sourced from PubChem (CID 158877915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).