C18H24F3NO2S2 — CID 158878347
O-ethyl [1-(2-acetamido-3,3,3-trifluoropropyl)-2-phenylcyclopropyl]sulfanylmethanethioate;methane (PubChem CID 158878347) has the molecular formula C18H24F3NO2S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is O-ethyl [1-(2-acetamido-3,3,3-trifluoropropyl)-2-phenylcyclopropyl]sulfanylmethanethioate;methane.
| Compound Name | O-ethyl [1-(2-acetamido-3,3,3-trifluoropropyl)-2-phenylcyclopropyl]sulfanylmethanethioate;methane |
|---|---|
| PubChem CID | 158878347 |
| Molecular Formula | C18H24F3NO2S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | O-ethyl [1-(2-acetamido-3,3,3-trifluoropropyl)-2-phenylcyclopropyl]sulfanylmethanethioate;methane |
| SMILES | C.CCOC(=S)SC1(CC(NC(C)=O)C(F)(F)F)CC1c1ccccc1 |
| InChI | InChI=1S/C17H20F3NO2S2.CH4/c1-3-23-15(24)25-16(9-13(16)12-7-5-4-6-8-12)10-14(17(18,19)20)21-11(2)22;/h4-8,13-14H,3,9-10H2,1-2H3,(H,21,22);1H4 |
| InChIKey | JCSLJJGYQVPMGQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|