About 2-fluoroaniline;formic acid
2-fluoroaniline;formic acid (PubChem CID 158878757) has the molecular formula C7H8FNO2
and a molecular weight of 157.14 g/mol. Its IUPAC name is 2-fluoroaniline;formic acid.
Molecular Properties
| Compound Name | 2-fluoroaniline;formic acid |
| PubChem CID | 158878757 |
| Molecular Formula | C7H8FNO2 |
| Molecular Weight | 157.14 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 2-fluoroaniline;formic acid |
| SMILES | Nc1ccccc1F.O=CO |
| InChI | InChI=1S/C6H6FN.CH2O2/c7-5-3-1-2-4-6(5)8;2-1-3/h1-4H,8H2;1H,(H,2,3) |
| InChIKey | JCTRYKLXXYJFJF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.14 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroaniline;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroaniline;formic acid?
The IUPAC name of 2-fluoroaniline;formic acid (CID 158878757) is 2-fluoroaniline;formic acid.
What is the SMILES notation for 2-fluoroaniline;formic acid?
The canonical SMILES for 2-fluoroaniline;formic acid is Nc1ccccc1F.O=CO.
What is the InChIKey of 2-fluoroaniline;formic acid?
The InChIKey is JCTRYKLXXYJFJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FN.CH2O2/c7-5-3-1-2-4-6(5)8;2-1-3/h1-4H,8H2;1H,(H,2,3).
What are the key properties of 2-fluoroaniline;formic acid?
2-fluoroaniline;formic acid has a molecular weight of 157.14 g/mol, XLogP of 1.11, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroaniline;formic acid is sourced from PubChem (CID 158878757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).