C6H8Cl3NO2 — CID 158879492
2,3-dihydrofuran;2,2,2-trichloroacetamide (PubChem CID 158879492) has the molecular formula C6H8Cl3NO2 and a molecular weight of 232.49 g/mol. Its IUPAC name is 2,3-dihydrofuran;2,2,2-trichloroacetamide.
| Compound Name | 2,3-dihydrofuran;2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 158879492 |
| Molecular Formula | C6H8Cl3NO2 |
| Molecular Weight | 232.49 g/mol |
| Exact Mass | 230.96 |
| IUPAC Name | 2,3-dihydrofuran;2,2,2-trichloroacetamide |
| SMILES | C1=COCC1.NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H6O.C2H2Cl3NO/c1-2-4-5-3-1;3-2(4,5)1(6)7/h1,3H,2,4H2;(H2,6,7) |
| InChIKey | JCVXQJRRRHEPIT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|