C12H24N2 — CID 15887952
2-(2-ethylbutyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 15887952) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 2-(2-ethylbutyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | 2-(2-ethylbutyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 15887952 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 2-(2-ethylbutyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | CCC(CC)CC1CCCCC(N)=N1 |
| InChI | InChI=1S/C12H24N2/c1-3-10(4-2)9-11-7-5-6-8-12(13)14-11/h10-11H,3-9H2,1-2H3,(H2,13,14) |
| InChIKey | OJPFBTWGXRGXAP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |