C28H30F3N7O2 — CID 158880353
4-[5-[(4-cyclopropyl-1H-indazol-5-yl)methyl]-1-methyl-1,2,4-triazol-3-yl]-2-methoxy-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]benzamide (PubChem CID 158880353) has the molecular formula C28H30F3N7O2 and a molecular weight of 553.59 g/mol. Its IUPAC name is 4-[5-[(4-cyclopropyl-1H-indazol-5-yl)methyl]-1-methyl-1,2,4-triazol-3-yl]-2-methoxy-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]benzamide.
| Compound Name | 4-[5-[(4-cyclopropyl-1H-indazol-5-yl)methyl]-1-methyl-1,2,4-triazol-3-yl]-2-methoxy-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 158880353 |
| Molecular Formula | C28H30F3N7O2 |
| Molecular Weight | 553.59 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 4-[5-[(4-cyclopropyl-1H-indazol-5-yl)methyl]-1-methyl-1,2,4-triazol-3-yl]-2-methoxy-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]benzamide |
| SMILES | COc1cc(-c2nc(Cc3ccc4[nH]ncc4c3C3CC3)n(C)n2)ccc1C(=O)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C28H30F3N7O2/c1-37-24(12-17-6-8-22-21(13-32-35-22)25(17)16-3-4-16)34-26(36-37)18-5-7-20(23(11-18)40-2)27(39)33-19-9-10-38(14-19)15-28(29,30)31/h5-8,11,13,16,19H,3-4,9-10,12,14-15H2,1-2H3,(H,32,35)(H,33,39) |
| InChIKey | JCYMQFMQVQNRGC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |