About 4-trimethylsilylcyclohexan-1-ol;(4-trimethylsilylcyclohexyl) methanesulfonate
4-trimethylsilylcyclohexan-1-ol;(4-trimethylsilylcyclohexyl) methanesulfonate (PubChem CID 158880404) has the molecular formula C19H42O4SSi2
and a molecular weight of 422.78 g/mol. Its IUPAC name is 4-trimethylsilylcyclohexan-1-ol;(4-trimethylsilylcyclohexyl) methanesulfonate.
Molecular Properties
| Compound Name | 4-trimethylsilylcyclohexan-1-ol;(4-trimethylsilylcyclohexyl) methanesulfonate |
| PubChem CID | 158880404 |
| Molecular Formula | C19H42O4SSi2 |
| Molecular Weight | 422.78 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 4-trimethylsilylcyclohexan-1-ol;(4-trimethylsilylcyclohexyl) methanesulfonate |
| SMILES | C[Si](C)(C)C1CCC(O)CC1.C[Si](C)(C)C1CCC(OS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C10H22O3SSi.C9H20OSi/c1-14(11,12)13-9-5-7-10(8-6-9)15(2,3)4;1-11(2,3)9-6-4-8(10)5-7-9/h9-10H,5-8H2,1-4H3;8-10H,4-7H2,1-3H3 |
| InChIKey | JCYOVQITWBAMGP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.78 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 4-trimethylsilylcyclohexan-1-ol;(4-trimethylsilylcyclohexyl) methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-trimethylsilylcyclohexan-1-ol;(4-trimethylsilylcyclohexyl) methanesulfonate?
The IUPAC name of 4-trimethylsilylcyclohexan-1-ol;(4-trimethylsilylcyclohexyl) methanesulfonate (CID 158880404) is 4-trimethylsilylcyclohexan-1-ol;(4-trimethylsilylcyclohexyl) methanesulfonate.
What is the SMILES notation for 4-trimethylsilylcyclohexan-1-ol;(4-trimethylsilylcyclohexyl) methanesulfonate?
The canonical SMILES for 4-trimethylsilylcyclohexan-1-ol;(4-trimethylsilylcyclohexyl) methanesulfonate is C[Si](C)(C)C1CCC(O)CC1.C[Si](C)(C)C1CCC(OS(C)(=O)=O)CC1.
What is the InChIKey of 4-trimethylsilylcyclohexan-1-ol;(4-trimethylsilylcyclohexyl) methanesulfonate?
The InChIKey is JCYOVQITWBAMGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O3SSi.C9H20OSi/c1-14(11,12)13-9-5-7-10(8-6-9)15(2,3)4;1-11(2,3)9-6-4-8(10)5-7-9/h9-10H,5-8H2,1-4H3;8-10H,4-7H2,1-3H3.
What are the key properties of 4-trimethylsilylcyclohexan-1-ol;(4-trimethylsilylcyclohexyl) methanesulfonate?
4-trimethylsilylcyclohexan-1-ol;(4-trimethylsilylcyclohexyl) methanesulfonate has a molecular weight of 422.78 g/mol, XLogP of 5.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-trimethylsilylcyclohexan-1-ol;(4-trimethylsilylcyclohexyl) methanesulfonate is sourced from PubChem (CID 158880404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).