C25H32O5S — CID 15888070
(4aS,6S,7S,7aR)-2,2-dimethyl-7-(3-phenylmethoxypropoxy)-6-(phenylsulfanylmethyl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine (PubChem CID 15888070) has the molecular formula C25H32O5S and a molecular weight of 444.59 g/mol. Its IUPAC name is (4aS,6S,7S,7aR)-2,2-dimethyl-7-(3-phenylmethoxypropoxy)-6-(phenylsulfanylmethyl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine.
| Compound Name | (4aS,6S,7S,7aR)-2,2-dimethyl-7-(3-phenylmethoxypropoxy)-6-(phenylsulfanylmethyl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 15888070 |
| Molecular Formula | C25H32O5S |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (4aS,6S,7S,7aR)-2,2-dimethyl-7-(3-phenylmethoxypropoxy)-6-(phenylsulfanylmethyl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine |
| SMILES | CC1(C)OC[C@@H]2O[C@H](CSc3ccccc3)[C@@H](OCCCOCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C25H32O5S/c1-25(2)28-17-21-24(30-25)23(22(29-21)18-31-20-12-7-4-8-13-20)27-15-9-14-26-16-19-10-5-3-6-11-19/h3-8,10-13,21-24H,9,14-18H2,1-2H3/t21-,22+,23+,24+/m0/s1 |
| InChIKey | DZJWNPJEFKFFOI-OLKYXYMISA-N |
| XLogP | 4.69 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|