C29H34O7S2 — CID 15888072
[(2S,3R,4S,5S)-3-hydroxy-4-(3-phenylmethoxypropoxy)-5-(phenylsulfanylmethyl)oxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 15888072) has the molecular formula C29H34O7S2 and a molecular weight of 558.72 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-3-hydroxy-4-(3-phenylmethoxypropoxy)-5-(phenylsulfanylmethyl)oxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,3R,4S,5S)-3-hydroxy-4-(3-phenylmethoxypropoxy)-5-(phenylsulfanylmethyl)oxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15888072 |
| Molecular Formula | C29H34O7S2 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | [(2S,3R,4S,5S)-3-hydroxy-4-(3-phenylmethoxypropoxy)-5-(phenylsulfanylmethyl)oxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2O[C@H](CSc3ccccc3)[C@@H](OCCCOCc3ccccc3)[C@@H]2O)cc1 |
| InChI | InChI=1S/C29H34O7S2/c1-22-13-15-25(16-14-22)38(31,32)35-20-26-28(30)29(27(36-26)21-37-24-11-6-3-7-12-24)34-18-8-17-33-19-23-9-4-2-5-10-23/h2-7,9-16,26-30H,8,17-21H2,1H3/t26-,27+,28+,29+/m0/s1 |
| InChIKey | HCDNSWMONDTFAY-AMSOURPBSA-N |
| XLogP | 4.61 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|