About 2-[3-[3-[4-(4-phenylphenyl)pyrazol-1-yl]phenoxy]phenoxy]pyridine;platinum
2-[3-[3-[4-(4-phenylphenyl)pyrazol-1-yl]phenoxy]phenoxy]pyridine;platinum (PubChem CID 158881190) has the molecular formula C32H23N3O2Pt
and a molecular weight of 676.63 g/mol. Its IUPAC name is 2-[3-[3-[4-(4-phenylphenyl)pyrazol-1-yl]phenoxy]phenoxy]pyridine;platinum.
Molecular Properties
| Compound Name | 2-[3-[3-[4-(4-phenylphenyl)pyrazol-1-yl]phenoxy]phenoxy]pyridine;platinum |
| PubChem CID | 158881190 |
| Molecular Formula | C32H23N3O2Pt |
| Molecular Weight | 676.63 g/mol |
| Exact Mass | 676.14 |
| IUPAC Name | 2-[3-[3-[4-(4-phenylphenyl)pyrazol-1-yl]phenoxy]phenoxy]pyridine;platinum |
| SMILES | [Pt].c1ccc(-c2ccc(-c3cnn(-c4cccc(Oc5cccc(Oc6ccccn6)c5)c4)c3)cc2)cc1 |
| InChI | InChI=1S/C32H23N3O2.Pt/c1-2-8-24(9-3-1)25-15-17-26(18-16-25)27-22-34-35(23-27)28-10-6-11-29(20-28)36-30-12-7-13-31(21-30)37-32-14-4-5-19-33-32;/h1-23H; |
| InChIKey | JDAVITXVURPLBF-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 676.63 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-[3-[4-(4-phenylphenyl)pyrazol-1-yl]phenoxy]phenoxy]pyridine;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[3-[4-(4-phenylphenyl)pyrazol-1-yl]phenoxy]phenoxy]pyridine;platinum?
The IUPAC name of 2-[3-[3-[4-(4-phenylphenyl)pyrazol-1-yl]phenoxy]phenoxy]pyridine;platinum (CID 158881190) is 2-[3-[3-[4-(4-phenylphenyl)pyrazol-1-yl]phenoxy]phenoxy]pyridine;platinum.
What is the SMILES notation for 2-[3-[3-[4-(4-phenylphenyl)pyrazol-1-yl]phenoxy]phenoxy]pyridine;platinum?
The canonical SMILES for 2-[3-[3-[4-(4-phenylphenyl)pyrazol-1-yl]phenoxy]phenoxy]pyridine;platinum is [Pt].c1ccc(-c2ccc(-c3cnn(-c4cccc(Oc5cccc(Oc6ccccn6)c5)c4)c3)cc2)cc1.
What is the InChIKey of 2-[3-[3-[4-(4-phenylphenyl)pyrazol-1-yl]phenoxy]phenoxy]pyridine;platinum?
The InChIKey is JDAVITXVURPLBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H23N3O2.Pt/c1-2-8-24(9-3-1)25-15-17-26(18-16-25)27-22-34-35(23-27)28-10-6-11-29(20-28)36-30-12-7-13-31(21-30)37-32-14-4-5-19-33-32;/h1-23H;.
What are the key properties of 2-[3-[3-[4-(4-phenylphenyl)pyrazol-1-yl]phenoxy]phenoxy]pyridine;platinum?
2-[3-[3-[4-(4-phenylphenyl)pyrazol-1-yl]phenoxy]phenoxy]pyridine;platinum has a molecular weight of 676.63 g/mol, XLogP of 8.18, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[3-[4-(4-phenylphenyl)pyrazol-1-yl]phenoxy]phenoxy]pyridine;platinum is sourced from PubChem (CID 158881190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).