C23H28F3N5 — CID 158881651
7-(4-methylcyclohexyl)-5-(2-methyl-4-pyridinyl)-N-[(2S)-4,4,4-trifluorobutan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 158881651) has the molecular formula C23H28F3N5 and a molecular weight of 431.51 g/mol. Its IUPAC name is 7-(4-methylcyclohexyl)-5-(2-methyl-4-pyridinyl)-N-[(2S)-4,4,4-trifluorobutan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 7-(4-methylcyclohexyl)-5-(2-methyl-4-pyridinyl)-N-[(2S)-4,4,4-trifluorobutan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 158881651 |
| Molecular Formula | C23H28F3N5 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 7-(4-methylcyclohexyl)-5-(2-methyl-4-pyridinyl)-N-[(2S)-4,4,4-trifluorobutan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | Cc1cc(-c2cc(C3CCC(C)CC3)n3nc(N[C@@H](C)CC(F)(F)F)ncc23)ccn1 |
| InChI | InChI=1S/C23H28F3N5/c1-14-4-6-17(7-5-14)20-11-19(18-8-9-27-15(2)10-18)21-13-28-22(30-31(20)21)29-16(3)12-23(24,25)26/h8-11,13-14,16-17H,4-7,12H2,1-3H3,(H,29,30)/t14?,16-,17?/m0/s1 |
| InChIKey | ULDLBMGBGWFLAV-WIHSUSGWSA-N |
| XLogP | 6.15 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |