About 5-(bromomethyl)-2,3-dichloropyridine;(5,6-dichloro-3-pyridinyl)methanol
5-(bromomethyl)-2,3-dichloropyridine;(5,6-dichloro-3-pyridinyl)methanol (PubChem CID 158882094) has the molecular formula C12H9BrCl4N2O
and a molecular weight of 418.93 g/mol. Its IUPAC name is 5-(bromomethyl)-2,3-dichloropyridine;(5,6-dichloro-3-pyridinyl)methanol.
Molecular Properties
| Compound Name | 5-(bromomethyl)-2,3-dichloropyridine;(5,6-dichloro-3-pyridinyl)methanol |
| PubChem CID | 158882094 |
| Molecular Formula | C12H9BrCl4N2O |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 415.87 |
| IUPAC Name | 5-(bromomethyl)-2,3-dichloropyridine;(5,6-dichloro-3-pyridinyl)methanol |
| SMILES | Clc1cc(CBr)cnc1Cl.OCc1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H4BrCl2N.C6H5Cl2NO/c7-2-4-1-5(8)6(9)10-3-4;7-5-1-4(3-10)2-9-6(5)8/h1,3H,2H2;1-2,10H,3H2 |
| InChIKey | JDDOWMLYNVGRPA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(bromomethyl)-2,3-dichloropyridine;(5,6-dichloro-3-pyridinyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(bromomethyl)-2,3-dichloropyridine;(5,6-dichloro-3-pyridinyl)methanol?
The IUPAC name of 5-(bromomethyl)-2,3-dichloropyridine;(5,6-dichloro-3-pyridinyl)methanol (CID 158882094) is 5-(bromomethyl)-2,3-dichloropyridine;(5,6-dichloro-3-pyridinyl)methanol.
What is the SMILES notation for 5-(bromomethyl)-2,3-dichloropyridine;(5,6-dichloro-3-pyridinyl)methanol?
The canonical SMILES for 5-(bromomethyl)-2,3-dichloropyridine;(5,6-dichloro-3-pyridinyl)methanol is Clc1cc(CBr)cnc1Cl.OCc1cnc(Cl)c(Cl)c1.
What is the InChIKey of 5-(bromomethyl)-2,3-dichloropyridine;(5,6-dichloro-3-pyridinyl)methanol?
The InChIKey is JDDOWMLYNVGRPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrCl2N.C6H5Cl2NO/c7-2-4-1-5(8)6(9)10-3-4;7-5-1-4(3-10)2-9-6(5)8/h1,3H,2H2;1-2,10H,3H2.
What are the key properties of 5-(bromomethyl)-2,3-dichloropyridine;(5,6-dichloro-3-pyridinyl)methanol?
5-(bromomethyl)-2,3-dichloropyridine;(5,6-dichloro-3-pyridinyl)methanol has a molecular weight of 418.93 g/mol, XLogP of 5.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(bromomethyl)-2,3-dichloropyridine;(5,6-dichloro-3-pyridinyl)methanol is sourced from PubChem (CID 158882094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).