C21H29N3O — CID 158882212
4-methyl-6-[[(1S,2S)-2-(4-pyridin-2-ylbutoxy)cyclopentyl]methyl]pyridin-2-amine (PubChem CID 158882212) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-methyl-6-[[(1S,2S)-2-(4-pyridin-2-ylbutoxy)cyclopentyl]methyl]pyridin-2-amine.
| Compound Name | 4-methyl-6-[[(1S,2S)-2-(4-pyridin-2-ylbutoxy)cyclopentyl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 158882212 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 4-methyl-6-[[(1S,2S)-2-(4-pyridin-2-ylbutoxy)cyclopentyl]methyl]pyridin-2-amine |
| SMILES | Cc1cc(N)nc(C[C@@H]2CCC[C@@H]2OCCCCc2ccccn2)c1 |
| InChI | InChI=1S/C21H29N3O/c1-16-13-19(24-21(22)14-16)15-17-7-6-10-20(17)25-12-5-3-9-18-8-2-4-11-23-18/h2,4,8,11,13-14,17,20H,3,5-7,9-10,12,15H2,1H3,(H2,22,24)/t17-,20-/m0/s1 |
| InChIKey | DBLIYYVAQCMASN-PXNSSMCTSA-N |
| XLogP | 4.12 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|