C49H53Cl2N5O6 — CID 158882238
bis(1-chloro-6-methoxy-3-(5-propan-2-yloxy-2-pyridinyl)isoquinoline);N,N-diethyl-4-methoxy-2-methylbenzamide (PubChem CID 158882238) has the molecular formula C49H53Cl2N5O6 and a molecular weight of 878.90 g/mol. Its IUPAC name is bis(1-chloro-6-methoxy-3-(5-propan-2-yloxy-2-pyridinyl)isoquinoline);N,N-diethyl-4-methoxy-2-methylbenzamide.
| Compound Name | bis(1-chloro-6-methoxy-3-(5-propan-2-yloxy-2-pyridinyl)isoquinoline);N,N-diethyl-4-methoxy-2-methylbenzamide |
|---|---|
| PubChem CID | 158882238 |
| Molecular Formula | C49H53Cl2N5O6 |
| Molecular Weight | 878.90 g/mol |
| Exact Mass | 877.34 |
| IUPAC Name | bis(1-chloro-6-methoxy-3-(5-propan-2-yloxy-2-pyridinyl)isoquinoline);N,N-diethyl-4-methoxy-2-methylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(OC)cc1C.COc1ccc2c(Cl)nc(-c3ccc(OC(C)C)cn3)cc2c1.COc1ccc2c(Cl)nc(-c3ccc(OC(C)C)cn3)cc2c1 |
| InChI | InChI=1S/2C18H17ClN2O2.C13H19NO2/c2*1-11(2)23-14-5-7-16(20-10-14)17-9-12-8-13(22-3)4-6-15(12)18(19)21-17;1-5-14(6-2)13(15)12-8-7-11(16-4)9-10(12)3/h2*4-11H,1-3H3;7-9H,5-6H2,1-4H3 |
| InChIKey | JDEAXIZQRCWEMZ-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 118.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.90 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|