About 4-tert-butyl-6-methylbenzene-1,2,3,5-tetrol
4-tert-butyl-6-methylbenzene-1,2,3,5-tetrol (PubChem CID 158882357) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is 4-tert-butyl-6-methylbenzene-1,2,3,5-tetrol.
Molecular Properties
| Compound Name | 4-tert-butyl-6-methylbenzene-1,2,3,5-tetrol |
| PubChem CID | 158882357 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-tert-butyl-6-methylbenzene-1,2,3,5-tetrol |
| SMILES | Cc1c(O)c(O)c(O)c(C(C)(C)C)c1O |
| InChI | InChI=1S/C11H16O4/c1-5-7(12)6(11(2,3)4)9(14)10(15)8(5)13/h12-15H,1-4H3 |
| InChIKey | LIRCEVZUIRJZSS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-6-methylbenzene-1,2,3,5-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-6-methylbenzene-1,2,3,5-tetrol?
The IUPAC name of 4-tert-butyl-6-methylbenzene-1,2,3,5-tetrol (CID 158882357) is 4-tert-butyl-6-methylbenzene-1,2,3,5-tetrol.
What is the SMILES notation for 4-tert-butyl-6-methylbenzene-1,2,3,5-tetrol?
The canonical SMILES for 4-tert-butyl-6-methylbenzene-1,2,3,5-tetrol is Cc1c(O)c(O)c(O)c(C(C)(C)C)c1O.
What is the InChIKey of 4-tert-butyl-6-methylbenzene-1,2,3,5-tetrol?
The InChIKey is LIRCEVZUIRJZSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4/c1-5-7(12)6(11(2,3)4)9(14)10(15)8(5)13/h12-15H,1-4H3.
What are the key properties of 4-tert-butyl-6-methylbenzene-1,2,3,5-tetrol?
4-tert-butyl-6-methylbenzene-1,2,3,5-tetrol has a molecular weight of 212.24 g/mol, XLogP of 2.11, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-6-methylbenzene-1,2,3,5-tetrol is sourced from PubChem (CID 158882357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).