C11H16O4 — CID 158883051
(3,3-dimethyl-2-oxobutyl) (Z)-4-oxopent-2-enoate (PubChem CID 158883051) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) (Z)-4-oxopent-2-enoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) (Z)-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 158883051 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) (Z)-4-oxopent-2-enoate |
| SMILES | CC(=O)/C=C\C(=O)OCC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H16O4/c1-8(12)5-6-10(14)15-7-9(13)11(2,3)4/h5-6H,7H2,1-4H3/b6-5- |
| InChIKey | YLDCTSXTZAUJPX-WAYWQWQTSA-N |
| XLogP | 1.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|