About 3-(1-benzyl-5-methylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;methane
3-(1-benzyl-5-methylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;methane (PubChem CID 158883315) has the molecular formula C21H29N3O
and a molecular weight of 339.48 g/mol. Its IUPAC name is 3-(1-benzyl-5-methylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;methane.
Molecular Properties
| Compound Name | 3-(1-benzyl-5-methylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;methane |
| PubChem CID | 158883315 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 3-(1-benzyl-5-methylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;methane |
| SMILES | C.Cc1ccc2c(c1)c(OCCCN(C)C)nn2Cc1ccccc1 |
| InChI | InChI=1S/C20H25N3O.CH4/c1-16-10-11-19-18(14-16)20(24-13-7-12-22(2)3)21-23(19)15-17-8-5-4-6-9-17;/h4-6,8-11,14H,7,12-13,15H2,1-3H3;1H4 |
| InChIKey | JDHLDTXNEXAVNZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-benzyl-5-methylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-benzyl-5-methylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;methane?
The IUPAC name of 3-(1-benzyl-5-methylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;methane (CID 158883315) is 3-(1-benzyl-5-methylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;methane.
What is the SMILES notation for 3-(1-benzyl-5-methylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;methane?
The canonical SMILES for 3-(1-benzyl-5-methylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;methane is C.Cc1ccc2c(c1)c(OCCCN(C)C)nn2Cc1ccccc1.
What is the InChIKey of 3-(1-benzyl-5-methylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;methane?
The InChIKey is JDHLDTXNEXAVNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O.CH4/c1-16-10-11-19-18(14-16)20(24-13-7-12-22(2)3)21-23(19)15-17-8-5-4-6-9-17;/h4-6,8-11,14H,7,12-13,15H2,1-3H3;1H4.
What are the key properties of 3-(1-benzyl-5-methylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;methane?
3-(1-benzyl-5-methylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;methane has a molecular weight of 339.48 g/mol, XLogP of 4.36, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-benzyl-5-methylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;methane is sourced from PubChem (CID 158883315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).