About 3,5-dimethyladamantan-1-amine;methane
3,5-dimethyladamantan-1-amine;methane (PubChem CID 158883426) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is 3,5-dimethyladamantan-1-amine;methane.
Molecular Properties
| Compound Name | 3,5-dimethyladamantan-1-amine;methane |
| PubChem CID | 158883426 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 3,5-dimethyladamantan-1-amine;methane |
| SMILES | C.CC12CC3CC(C)(C1)CC(N)(C3)C2 |
| InChI | InChI=1S/C12H21N.CH4/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;/h9H,3-8,13H2,1-2H3;1H4 |
| InChIKey | JDHSLTAMGVDAKP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-dimethyladamantan-1-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyladamantan-1-amine;methane?
The IUPAC name of 3,5-dimethyladamantan-1-amine;methane (CID 158883426) is 3,5-dimethyladamantan-1-amine;methane.
What is the SMILES notation for 3,5-dimethyladamantan-1-amine;methane?
The canonical SMILES for 3,5-dimethyladamantan-1-amine;methane is C.CC12CC3CC(C)(C1)CC(N)(C3)C2.
What is the InChIKey of 3,5-dimethyladamantan-1-amine;methane?
The InChIKey is JDHSLTAMGVDAKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N.CH4/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;/h9H,3-8,13H2,1-2H3;1H4.
What are the key properties of 3,5-dimethyladamantan-1-amine;methane?
3,5-dimethyladamantan-1-amine;methane has a molecular weight of 195.35 g/mol, XLogP of 3.33, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyladamantan-1-amine;methane is sourced from PubChem (CID 158883426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).