About 2-(2-aminoethyldisulfanyl)pyridine-3-carboxylic acid;2-sulfanylidene-1H-pyridine-3-carboxylic acid
2-(2-aminoethyldisulfanyl)pyridine-3-carboxylic acid;2-sulfanylidene-1H-pyridine-3-carboxylic acid (PubChem CID 158884321) has the molecular formula C14H15N3O4S3
and a molecular weight of 385.49 g/mol. Its IUPAC name is 2-(2-aminoethyldisulfanyl)pyridine-3-carboxylic acid;2-sulfanylidene-1H-pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-(2-aminoethyldisulfanyl)pyridine-3-carboxylic acid;2-sulfanylidene-1H-pyridine-3-carboxylic acid |
| PubChem CID | 158884321 |
| Molecular Formula | C14H15N3O4S3 |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 2-(2-aminoethyldisulfanyl)pyridine-3-carboxylic acid;2-sulfanylidene-1H-pyridine-3-carboxylic acid |
| SMILES | NCCSSc1ncccc1C(=O)O.O=C(O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C8H10N2O2S2.C6H5NO2S/c9-3-5-13-14-7-6(8(11)12)2-1-4-10-7;8-6(9)4-2-1-3-7-5(4)10/h1-2,4H,3,5,9H2,(H,11,12);1-3H,(H,7,10)(H,8,9) |
| InChIKey | JDKQATJQRAMZGC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethyldisulfanyl)pyridine-3-carboxylic acid;2-sulfanylidene-1H-pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyldisulfanyl)pyridine-3-carboxylic acid;2-sulfanylidene-1H-pyridine-3-carboxylic acid?
The IUPAC name of 2-(2-aminoethyldisulfanyl)pyridine-3-carboxylic acid;2-sulfanylidene-1H-pyridine-3-carboxylic acid (CID 158884321) is 2-(2-aminoethyldisulfanyl)pyridine-3-carboxylic acid;2-sulfanylidene-1H-pyridine-3-carboxylic acid.
What is the SMILES notation for 2-(2-aminoethyldisulfanyl)pyridine-3-carboxylic acid;2-sulfanylidene-1H-pyridine-3-carboxylic acid?
The canonical SMILES for 2-(2-aminoethyldisulfanyl)pyridine-3-carboxylic acid;2-sulfanylidene-1H-pyridine-3-carboxylic acid is NCCSSc1ncccc1C(=O)O.O=C(O)c1ccc[nH]c1=S.
What is the InChIKey of 2-(2-aminoethyldisulfanyl)pyridine-3-carboxylic acid;2-sulfanylidene-1H-pyridine-3-carboxylic acid?
The InChIKey is JDKQATJQRAMZGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2S2.C6H5NO2S/c9-3-5-13-14-7-6(8(11)12)2-1-4-10-7;8-6(9)4-2-1-3-7-5(4)10/h1-2,4H,3,5,9H2,(H,11,12);1-3H,(H,7,10)(H,8,9).
What are the key properties of 2-(2-aminoethyldisulfanyl)pyridine-3-carboxylic acid;2-sulfanylidene-1H-pyridine-3-carboxylic acid?
2-(2-aminoethyldisulfanyl)pyridine-3-carboxylic acid;2-sulfanylidene-1H-pyridine-3-carboxylic acid has a molecular weight of 385.49 g/mol, XLogP of 2.92, 6 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyldisulfanyl)pyridine-3-carboxylic acid;2-sulfanylidene-1H-pyridine-3-carboxylic acid is sourced from PubChem (CID 158884321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).