C9H10O2 — CID 158885304
2-methylbicyclo[4.2.0]octa-1,3,5-triene-3,4-diol (PubChem CID 158885304) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 2-methylbicyclo[4.2.0]octa-1,3,5-triene-3,4-diol.
| Compound Name | 2-methylbicyclo[4.2.0]octa-1,3,5-triene-3,4-diol |
|---|---|
| PubChem CID | 158885304 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 2-methylbicyclo[4.2.0]octa-1,3,5-triene-3,4-diol |
| SMILES | Cc1c(O)c(O)cc2c1CC2 |
| InChI | InChI=1S/C9H10O2/c1-5-7-3-2-6(7)4-8(10)9(5)11/h4,10-11H,2-3H2,1H3 |
| InChIKey | JDOAKDOKCQQVSD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|