About 4-[(3R,5S)-5-(4-chlorophenyl)-2,2-dimethylpyrrolidin-3-yl]pyridine;hydrochloride
4-[(3R,5S)-5-(4-chlorophenyl)-2,2-dimethylpyrrolidin-3-yl]pyridine;hydrochloride (PubChem CID 158885591) has the molecular formula C17H20Cl2N2
and a molecular weight of 323.27 g/mol. Its IUPAC name is 4-[(3R,5S)-5-(4-chlorophenyl)-2,2-dimethylpyrrolidin-3-yl]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 4-[(3R,5S)-5-(4-chlorophenyl)-2,2-dimethylpyrrolidin-3-yl]pyridine;hydrochloride |
| PubChem CID | 158885591 |
| Molecular Formula | C17H20Cl2N2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 4-[(3R,5S)-5-(4-chlorophenyl)-2,2-dimethylpyrrolidin-3-yl]pyridine;hydrochloride |
| SMILES | CC1(C)N[C@H](c2ccc(Cl)cc2)C[C@@H]1c1ccncc1.Cl |
| InChI | InChI=1S/C17H19ClN2.ClH/c1-17(2)15(12-7-9-19-10-8-12)11-16(20-17)13-3-5-14(18)6-4-13;/h3-10,15-16,20H,11H2,1-2H3;1H/t15-,16+;/m1./s1 |
| InChIKey | KQWISVGVFTZDRV-RCPFAERMSA-N |
| XLogP | 4.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(3R,5S)-5-(4-chlorophenyl)-2,2-dimethylpyrrolidin-3-yl]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3R,5S)-5-(4-chlorophenyl)-2,2-dimethylpyrrolidin-3-yl]pyridine;hydrochloride?
The IUPAC name of 4-[(3R,5S)-5-(4-chlorophenyl)-2,2-dimethylpyrrolidin-3-yl]pyridine;hydrochloride (CID 158885591) is 4-[(3R,5S)-5-(4-chlorophenyl)-2,2-dimethylpyrrolidin-3-yl]pyridine;hydrochloride.
What is the SMILES notation for 4-[(3R,5S)-5-(4-chlorophenyl)-2,2-dimethylpyrrolidin-3-yl]pyridine;hydrochloride?
The canonical SMILES for 4-[(3R,5S)-5-(4-chlorophenyl)-2,2-dimethylpyrrolidin-3-yl]pyridine;hydrochloride is CC1(C)N[C@H](c2ccc(Cl)cc2)C[C@@H]1c1ccncc1.Cl.
What is the InChIKey of 4-[(3R,5S)-5-(4-chlorophenyl)-2,2-dimethylpyrrolidin-3-yl]pyridine;hydrochloride?
The InChIKey is KQWISVGVFTZDRV-RCPFAERMSA-N. The full InChI is InChI=1S/C17H19ClN2.ClH/c1-17(2)15(12-7-9-19-10-8-12)11-16(20-17)13-3-5-14(18)6-4-13;/h3-10,15-16,20H,11H2,1-2H3;1H/t15-,16+;/m1./s1.
What are the key properties of 4-[(3R,5S)-5-(4-chlorophenyl)-2,2-dimethylpyrrolidin-3-yl]pyridine;hydrochloride?
4-[(3R,5S)-5-(4-chlorophenyl)-2,2-dimethylpyrrolidin-3-yl]pyridine;hydrochloride has a molecular weight of 323.27 g/mol, XLogP of 4.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3R,5S)-5-(4-chlorophenyl)-2,2-dimethylpyrrolidin-3-yl]pyridine;hydrochloride is sourced from PubChem (CID 158885591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).