C42H55N7+2 — CID 158885810
10-[3-[5-[3,6-bis(methylaminomethyl)acridin-10-ium-10-yl]pentylamino]propyl]-3-N,3-N,6-N,6-N-tetramethylacridin-10-ium-3,6-diamine (PubChem CID 158885810) has the molecular formula C42H55N7+2 and a molecular weight of 657.95 g/mol. Its IUPAC name is 10-[3-[5-[3,6-bis(methylaminomethyl)acridin-10-ium-10-yl]pentylamino]propyl]-3-N,3-N,6-N,6-N-tetramethylacridin-10-ium-3,6-diamine.
| Compound Name | 10-[3-[5-[3,6-bis(methylaminomethyl)acridin-10-ium-10-yl]pentylamino]propyl]-3-N,3-N,6-N,6-N-tetramethylacridin-10-ium-3,6-diamine |
|---|---|
| PubChem CID | 158885810 |
| Molecular Formula | C42H55N7+2 |
| Molecular Weight | 657.95 g/mol |
| Exact Mass | 657.45 |
| IUPAC Name | 10-[3-[5-[3,6-bis(methylaminomethyl)acridin-10-ium-10-yl]pentylamino]propyl]-3-N,3-N,6-N,6-N-tetramethylacridin-10-ium-3,6-diamine |
| SMILES | CNCc1ccc2cc3ccc(CNC)cc3[n+](CCCCCNCCC[n+]3c4cc(N(C)C)ccc4cc4ccc(N(C)C)cc43)c2c1 |
| InChI | InChI=1S/C42H55N7/c1-43-29-31-11-13-33-25-34-14-12-32(30-44-2)24-40(34)48(39(33)23-31)21-9-7-8-19-45-20-10-22-49-41-27-37(46(3)4)17-15-35(41)26-36-16-18-38(47(5)6)28-42(36)49/h11-18,23-28,43-45H,7-10,19-22,29-30H2,1-6H3/q+2 |
| InChIKey | NUXMXZKDTHZCDB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 50.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.95 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|