C17H25N3O4 — CID 158885938
1-(1-amino-3-methylbutan-2-yl)pyrrole-2,5-dione;1-(2-methylpropyl)pyrrole-2,5-dione (PubChem CID 158885938) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-(1-amino-3-methylbutan-2-yl)pyrrole-2,5-dione;1-(2-methylpropyl)pyrrole-2,5-dione.
| Compound Name | 1-(1-amino-3-methylbutan-2-yl)pyrrole-2,5-dione;1-(2-methylpropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 158885938 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-(1-amino-3-methylbutan-2-yl)pyrrole-2,5-dione;1-(2-methylpropyl)pyrrole-2,5-dione |
| SMILES | CC(C)C(CN)N1C(=O)C=CC1=O.CC(C)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H14N2O2.C8H11NO2/c1-6(2)7(5-10)11-8(12)3-4-9(11)13;1-6(2)5-9-7(10)3-4-8(9)11/h3-4,6-7H,5,10H2,1-2H3;3-4,6H,5H2,1-2H3 |
| InChIKey | JDQANKHRYGLPDJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|