About 1-iminopropan-2-ol;hydrochloride
1-iminopropan-2-ol;hydrochloride (PubChem CID 158886323) has the molecular formula C3H8ClNO
and a molecular weight of 109.56 g/mol. Its IUPAC name is 1-iminopropan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-iminopropan-2-ol;hydrochloride |
| PubChem CID | 158886323 |
| Molecular Formula | C3H8ClNO |
| Molecular Weight | 109.56 g/mol |
| Exact Mass | 109.03 |
| IUPAC Name | 1-iminopropan-2-ol;hydrochloride |
| SMILES | Cl.[H]/N=C/C(C)O |
| InChI | InChI=1S/C3H7NO.ClH/c1-3(5)2-4;/h2-5H,1H3;1H/b4-2+; |
| InChIKey | JDRFTWBYGPFIMC-VEELZWTKSA-N |
| XLogP | 0.44 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.56 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-iminopropan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iminopropan-2-ol;hydrochloride?
The IUPAC name of 1-iminopropan-2-ol;hydrochloride (CID 158886323) is 1-iminopropan-2-ol;hydrochloride.
What is the SMILES notation for 1-iminopropan-2-ol;hydrochloride?
The canonical SMILES for 1-iminopropan-2-ol;hydrochloride is Cl.[H]/N=C/C(C)O.
What is the InChIKey of 1-iminopropan-2-ol;hydrochloride?
The InChIKey is JDRFTWBYGPFIMC-VEELZWTKSA-N. The full InChI is InChI=1S/C3H7NO.ClH/c1-3(5)2-4;/h2-5H,1H3;1H/b4-2+;.
What are the key properties of 1-iminopropan-2-ol;hydrochloride?
1-iminopropan-2-ol;hydrochloride has a molecular weight of 109.56 g/mol, XLogP of 0.44, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iminopropan-2-ol;hydrochloride is sourced from PubChem (CID 158886323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).