C37H40N2O9 — CID 158886401
[(2R)-1-[(2S,3R,4R,5R)-5-[(2R)-2-benzoyloxybutyl]-3-benzyl-4-methyloxolan-2-yl]-4-methyl-3-methylidenepent-4-en-2-yl] 3,5-dinitrobenzoate (PubChem CID 158886401) has the molecular formula C37H40N2O9 and a molecular weight of 656.73 g/mol. Its IUPAC name is [(2R)-1-[(2S,3R,4R,5R)-5-[(2R)-2-benzoyloxybutyl]-3-benzyl-4-methyloxolan-2-yl]-4-methyl-3-methylidenepent-4-en-2-yl] 3,5-dinitrobenzoate.
| Compound Name | [(2R)-1-[(2S,3R,4R,5R)-5-[(2R)-2-benzoyloxybutyl]-3-benzyl-4-methyloxolan-2-yl]-4-methyl-3-methylidenepent-4-en-2-yl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 158886401 |
| Molecular Formula | C37H40N2O9 |
| Molecular Weight | 656.73 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | [(2R)-1-[(2S,3R,4R,5R)-5-[(2R)-2-benzoyloxybutyl]-3-benzyl-4-methyloxolan-2-yl]-4-methyl-3-methylidenepent-4-en-2-yl] 3,5-dinitrobenzoate |
| SMILES | C=C(C)C(=C)[C@@H](C[C@@H]1O[C@H](C[C@@H](CC)OC(=O)c2ccccc2)[C@H](C)[C@H]1Cc1ccccc1)OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C37H40N2O9/c1-6-31(46-36(40)27-15-11-8-12-16-27)21-33-25(5)32(17-26-13-9-7-10-14-26)35(47-33)22-34(24(4)23(2)3)48-37(41)28-18-29(38(42)43)20-30(19-28)39(44)45/h7-16,18-20,25,31-35H,2,4,6,17,21-22H2,1,3,5H3/t25-,31-,32-,33-,34-,35+/m1/s1 |
| InChIKey | UICBPECCSLETEP-AVGIJNQDSA-N |
| XLogP | 7.84 |
| TPSA | 148.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.73 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|