About 3-deuterio-1-[4-hydroxy-3-(methylamino)-6-propan-2-yloxyoxan-2-yl]propane-1,2-diol;formic acid
3-deuterio-1-[4-hydroxy-3-(methylamino)-6-propan-2-yloxyoxan-2-yl]propane-1,2-diol;formic acid (PubChem CID 158886606) has the molecular formula C13H27NO7
and a molecular weight of 310.37 g/mol. Its IUPAC name is 3-deuterio-1-[4-hydroxy-3-(methylamino)-6-propan-2-yloxyoxan-2-yl]propane-1,2-diol;formic acid.
Molecular Properties
| Compound Name | 3-deuterio-1-[4-hydroxy-3-(methylamino)-6-propan-2-yloxyoxan-2-yl]propane-1,2-diol;formic acid |
| PubChem CID | 158886606 |
| Molecular Formula | C13H27NO7 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 3-deuterio-1-[4-hydroxy-3-(methylamino)-6-propan-2-yloxyoxan-2-yl]propane-1,2-diol;formic acid |
| SMILES | O=CO.[2H]CC(O)C(O)C1OC(OC(C)C)CC(O)C1NC |
| InChI | InChI=1S/C12H25NO5.CH2O2/c1-6(2)17-9-5-8(15)10(13-4)12(18-9)11(16)7(3)14;2-1-3/h6-16H,5H2,1-4H3;1H,(H,2,3)/i3D; |
| InChIKey | JDSCEBKPBFPXIE-RFQDWOGUSA-N |
| XLogP | -1.08 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-deuterio-1-[4-hydroxy-3-(methylamino)-6-propan-2-yloxyoxan-2-yl]propane-1,2-diol;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-deuterio-1-[4-hydroxy-3-(methylamino)-6-propan-2-yloxyoxan-2-yl]propane-1,2-diol;formic acid?
The IUPAC name of 3-deuterio-1-[4-hydroxy-3-(methylamino)-6-propan-2-yloxyoxan-2-yl]propane-1,2-diol;formic acid (CID 158886606) is 3-deuterio-1-[4-hydroxy-3-(methylamino)-6-propan-2-yloxyoxan-2-yl]propane-1,2-diol;formic acid.
What is the SMILES notation for 3-deuterio-1-[4-hydroxy-3-(methylamino)-6-propan-2-yloxyoxan-2-yl]propane-1,2-diol;formic acid?
The canonical SMILES for 3-deuterio-1-[4-hydroxy-3-(methylamino)-6-propan-2-yloxyoxan-2-yl]propane-1,2-diol;formic acid is O=CO.[2H]CC(O)C(O)C1OC(OC(C)C)CC(O)C1NC.
What is the InChIKey of 3-deuterio-1-[4-hydroxy-3-(methylamino)-6-propan-2-yloxyoxan-2-yl]propane-1,2-diol;formic acid?
The InChIKey is JDSCEBKPBFPXIE-RFQDWOGUSA-N. The full InChI is InChI=1S/C12H25NO5.CH2O2/c1-6(2)17-9-5-8(15)10(13-4)12(18-9)11(16)7(3)14;2-1-3/h6-16H,5H2,1-4H3;1H,(H,2,3)/i3D;.
What are the key properties of 3-deuterio-1-[4-hydroxy-3-(methylamino)-6-propan-2-yloxyoxan-2-yl]propane-1,2-diol;formic acid?
3-deuterio-1-[4-hydroxy-3-(methylamino)-6-propan-2-yloxyoxan-2-yl]propane-1,2-diol;formic acid has a molecular weight of 310.37 g/mol, XLogP of -1.08, 6 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-deuterio-1-[4-hydroxy-3-(methylamino)-6-propan-2-yloxyoxan-2-yl]propane-1,2-diol;formic acid is sourced from PubChem (CID 158886606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).