C12H19NO4S — CID 158887122
(2S)-2-(benzenesulfonamido)-3-methylbutanoic acid;methane (PubChem CID 158887122) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-3-methylbutanoic acid;methane.
| Compound Name | (2S)-2-(benzenesulfonamido)-3-methylbutanoic acid;methane |
|---|---|
| PubChem CID | 158887122 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)-3-methylbutanoic acid;methane |
| SMILES | C.CC(C)[C@H](NS(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H15NO4S.CH4/c1-8(2)10(11(13)14)12-17(15,16)9-6-4-3-5-7-9;/h3-8,10,12H,1-2H3,(H,13,14);1H4/t10-;/m0./s1 |
| InChIKey | JDTQEMMYZHPQIS-PPHPATTJSA-N |
| XLogP | 1.71 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |