C11H14N4 — CID 158887436
5-piperidin-1-yl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 158887436) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 5-piperidin-1-yl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-piperidin-1-yl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 158887436 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 5-piperidin-1-yl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | c1cc(N2CCCCC2)n2ncnc2c1 |
| InChI | InChI=1S/C11H14N4/c1-2-7-14(8-3-1)11-6-4-5-10-12-9-13-15(10)11/h4-6,9H,1-3,7-8H2 |
| InChIKey | MUSOLQQBINKCGT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |