C37H69NO2 — CID 158888634
7-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine;2-tert-butylbicyclo[2.2.1]heptane;9-tert-butyl-3-oxaspiro[5.5]undecane (PubChem CID 158888634) has the molecular formula C37H69NO2 and a molecular weight of 559.96 g/mol. Its IUPAC name is 7-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine;2-tert-butylbicyclo[2.2.1]heptane;9-tert-butyl-3-oxaspiro[5.5]undecane.
| Compound Name | 7-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine;2-tert-butylbicyclo[2.2.1]heptane;9-tert-butyl-3-oxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 158888634 |
| Molecular Formula | C37H69NO2 |
| Molecular Weight | 559.96 g/mol |
| Exact Mass | 559.53 |
| IUPAC Name | 7-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine;2-tert-butylbicyclo[2.2.1]heptane;9-tert-butyl-3-oxaspiro[5.5]undecane |
| SMILES | CC(C)(C)C1CC2CCC1C2.CC(C)(C)C1CCC2(CCOCC2)CC1.CC(C)(C)C1CCC2NCCOC2C1 |
| InChI | InChI=1S/C14H26O.C12H23NO.C11H20/c1-13(2,3)12-4-6-14(7-5-12)8-10-15-11-9-14;1-12(2,3)9-4-5-10-11(8-9)14-7-6-13-10;1-11(2,3)10-7-8-4-5-9(10)6-8/h12H,4-11H2,1-3H3;9-11,13H,4-8H2,1-3H3;8-10H,4-7H2,1-3H3 |
| InChIKey | JDYCPUVAAGJGKJ-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.96 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |