C15H22N2O4 — CID 158888854
1,2,4,5,6,7-hexahydroindazol-3-one;methyl 2-oxocyclohexane-1-carboxylate (PubChem CID 158888854) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1,2,4,5,6,7-hexahydroindazol-3-one;methyl 2-oxocyclohexane-1-carboxylate.
| Compound Name | 1,2,4,5,6,7-hexahydroindazol-3-one;methyl 2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 158888854 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1,2,4,5,6,7-hexahydroindazol-3-one;methyl 2-oxocyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCCC1=O.O=c1[nH][nH]c2c1CCCC2 |
| InChI | InChI=1S/C8H12O3.C7H10N2O/c1-11-8(10)6-4-2-3-5-7(6)9;10-7-5-3-1-2-4-6(5)8-9-7/h6H,2-5H2,1H3;1-4H2,(H2,8,9,10) |
| InChIKey | JDYTYCRTYGJXKD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|