C11H10N4O4 — CID 158890012
5-prop-1-ynyl-1H-pyrimidine-2,4-dione;1H-pyrimidine-2,4-dione (PubChem CID 158890012) has the molecular formula C11H10N4O4 and a molecular weight of 262.23 g/mol. Its IUPAC name is 5-prop-1-ynyl-1H-pyrimidine-2,4-dione;1H-pyrimidine-2,4-dione.
| Compound Name | 5-prop-1-ynyl-1H-pyrimidine-2,4-dione;1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 158890012 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 5-prop-1-ynyl-1H-pyrimidine-2,4-dione;1H-pyrimidine-2,4-dione |
| SMILES | CC#Cc1c[nH]c(=O)[nH]c1=O.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C7H6N2O2.C4H4N2O2/c1-2-3-5-4-8-7(11)9-6(5)10;7-3-1-2-5-4(8)6-3/h4H,1H3,(H2,8,9,10,11);1-2H,(H2,5,6,7,8) |
| InChIKey | JECMJJZOKFIJTL-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|