About carbon dioxide;2-chloro-5-(4-ethyl-1,3-oxazol-2-yl)-N-propan-2-ylpyridin-4-amine
carbon dioxide;2-chloro-5-(4-ethyl-1,3-oxazol-2-yl)-N-propan-2-ylpyridin-4-amine (PubChem CID 158890623) has the molecular formula C14H16ClN3O3
and a molecular weight of 309.75 g/mol. Its IUPAC name is carbon dioxide;2-chloro-5-(4-ethyl-1,3-oxazol-2-yl)-N-propan-2-ylpyridin-4-amine.
Molecular Properties
| Compound Name | carbon dioxide;2-chloro-5-(4-ethyl-1,3-oxazol-2-yl)-N-propan-2-ylpyridin-4-amine |
| PubChem CID | 158890623 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | carbon dioxide;2-chloro-5-(4-ethyl-1,3-oxazol-2-yl)-N-propan-2-ylpyridin-4-amine |
| SMILES | CCc1coc(-c2cnc(Cl)cc2NC(C)C)n1.O=C=O |
| InChI | InChI=1S/C13H16ClN3O.CO2/c1-4-9-7-18-13(17-9)10-6-15-12(14)5-11(10)16-8(2)3;2-1-3/h5-8H,4H2,1-3H3,(H,15,16); |
| InChIKey | JEEKUHSPBFPJBF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;2-chloro-5-(4-ethyl-1,3-oxazol-2-yl)-N-propan-2-ylpyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;2-chloro-5-(4-ethyl-1,3-oxazol-2-yl)-N-propan-2-ylpyridin-4-amine?
The IUPAC name of carbon dioxide;2-chloro-5-(4-ethyl-1,3-oxazol-2-yl)-N-propan-2-ylpyridin-4-amine (CID 158890623) is carbon dioxide;2-chloro-5-(4-ethyl-1,3-oxazol-2-yl)-N-propan-2-ylpyridin-4-amine.
What is the SMILES notation for carbon dioxide;2-chloro-5-(4-ethyl-1,3-oxazol-2-yl)-N-propan-2-ylpyridin-4-amine?
The canonical SMILES for carbon dioxide;2-chloro-5-(4-ethyl-1,3-oxazol-2-yl)-N-propan-2-ylpyridin-4-amine is CCc1coc(-c2cnc(Cl)cc2NC(C)C)n1.O=C=O.
What is the InChIKey of carbon dioxide;2-chloro-5-(4-ethyl-1,3-oxazol-2-yl)-N-propan-2-ylpyridin-4-amine?
The InChIKey is JEEKUHSPBFPJBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClN3O.CO2/c1-4-9-7-18-13(17-9)10-6-15-12(14)5-11(10)16-8(2)3;2-1-3/h5-8H,4H2,1-3H3,(H,15,16);.
What are the key properties of carbon dioxide;2-chloro-5-(4-ethyl-1,3-oxazol-2-yl)-N-propan-2-ylpyridin-4-amine?
carbon dioxide;2-chloro-5-(4-ethyl-1,3-oxazol-2-yl)-N-propan-2-ylpyridin-4-amine has a molecular weight of 309.75 g/mol, XLogP of 3.19, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;2-chloro-5-(4-ethyl-1,3-oxazol-2-yl)-N-propan-2-ylpyridin-4-amine is sourced from PubChem (CID 158890623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).