C46H43ClF6N12S2 — CID 158891455
bis(5-[[[(1R,3R)-3-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentyl]amino]methyl]-1H-indole-2-carbonitrile);hydrochloride (PubChem CID 158891455) has the molecular formula C46H43ClF6N12S2 and a molecular weight of 977.51 g/mol. Its IUPAC name is bis(5-[[[(1R,3R)-3-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentyl]amino]methyl]-1H-indole-2-carbonitrile);hydrochloride.
| Compound Name | bis(5-[[[(1R,3R)-3-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentyl]amino]methyl]-1H-indole-2-carbonitrile);hydrochloride |
|---|---|
| PubChem CID | 158891455 |
| Molecular Formula | C46H43ClF6N12S2 |
| Molecular Weight | 977.51 g/mol |
| Exact Mass | 976.28 |
| IUPAC Name | bis(5-[[[(1R,3R)-3-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentyl]amino]methyl]-1H-indole-2-carbonitrile);hydrochloride |
| SMILES | Cl.N#Cc1cc2cc(CN[C@@H]3CC[C@@H](Nc4ncnc5sc(CC(F)(F)F)cc45)C3)ccc2[nH]1.N#Cc1cc2cc(CN[C@@H]3CC[C@@H](Nc4ncnc5sc(CC(F)(F)F)cc45)C3)ccc2[nH]1 |
| InChI | InChI=1S/2C23H21F3N6S.ClH/c2*24-23(25,26)9-18-8-19-21(29-12-30-22(19)33-18)32-16-3-2-15(7-16)28-11-13-1-4-20-14(5-13)6-17(10-27)31-20;/h2*1,4-6,8,12,15-16,28,31H,2-3,7,9,11H2,(H,29,30,32);1H/t2*15-,16-;/m11./s1 |
| InChIKey | KDENBCDOGQKRNF-CVXYEZHBSA-N |
| XLogP | 10.97 |
| TPSA | 178.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 67 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.51 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |