C26H21F4N3O3 — CID 158891668
3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]benzimidazole-4-carboxylic acid (PubChem CID 158891668) has the molecular formula C26H21F4N3O3 and a molecular weight of 499.46 g/mol. Its IUPAC name is 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]benzimidazole-4-carboxylic acid.
| Compound Name | 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 158891668 |
| Molecular Formula | C26H21F4N3O3 |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]benzimidazole-4-carboxylic acid |
| SMILES | Cn1cnc2cc(-c3c(F)c(F)c(-c4cccc(CN5CCOCC5)c4)c(F)c3F)cc(C(=O)O)c21 |
| InChI | InChI=1S/C26H21F4N3O3/c1-32-13-31-18-11-16(10-17(25(18)32)26(34)35)20-23(29)21(27)19(22(28)24(20)30)15-4-2-3-14(9-15)12-33-5-7-36-8-6-33/h2-4,9-11,13H,5-8,12H2,1H3,(H,34,35) |
| InChIKey | ZRHJYCAHRFSCOX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|