C9H17NO — CID 158892420
(6aR)-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-amine (PubChem CID 158892420) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (6aR)-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-amine.
| Compound Name | (6aR)-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-amine |
|---|---|
| PubChem CID | 158892420 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (6aR)-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-amine |
| SMILES | CN(C)C1CO[C@@H]2CCCC12 |
| InChI | InChI=1S/C9H17NO/c1-10(2)8-6-11-9-5-3-4-7(8)9/h7-9H,3-6H2,1-2H3/t7?,8?,9-/m1/s1 |
| InChIKey | JEKDQHXDZUUNNK-AMDVSUOASA-N |
| XLogP | 1.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |