About propan-2-yl 3-methyl-2-[N-(2,2,2-trifluoroethyl)anilino]butanoate
propan-2-yl 3-methyl-2-[N-(2,2,2-trifluoroethyl)anilino]butanoate (PubChem CID 158892955) has the molecular formula C16H22F3NO2
and a molecular weight of 317.35 g/mol. Its IUPAC name is propan-2-yl 3-methyl-2-[N-(2,2,2-trifluoroethyl)anilino]butanoate.
Molecular Properties
| Compound Name | propan-2-yl 3-methyl-2-[N-(2,2,2-trifluoroethyl)anilino]butanoate |
| PubChem CID | 158892955 |
| Molecular Formula | C16H22F3NO2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | propan-2-yl 3-methyl-2-[N-(2,2,2-trifluoroethyl)anilino]butanoate |
| SMILES | CC(C)OC(=O)C(C(C)C)N(CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H22F3NO2/c1-11(2)14(15(21)22-12(3)4)20(10-16(17,18)19)13-8-6-5-7-9-13/h5-9,11-12,14H,10H2,1-4H3 |
| InChIKey | ZTXHCDQVQCYQPH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 3-methyl-2-[N-(2,2,2-trifluoroethyl)anilino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 3-methyl-2-[N-(2,2,2-trifluoroethyl)anilino]butanoate?
The IUPAC name of propan-2-yl 3-methyl-2-[N-(2,2,2-trifluoroethyl)anilino]butanoate (CID 158892955) is propan-2-yl 3-methyl-2-[N-(2,2,2-trifluoroethyl)anilino]butanoate.
What is the SMILES notation for propan-2-yl 3-methyl-2-[N-(2,2,2-trifluoroethyl)anilino]butanoate?
The canonical SMILES for propan-2-yl 3-methyl-2-[N-(2,2,2-trifluoroethyl)anilino]butanoate is CC(C)OC(=O)C(C(C)C)N(CC(F)(F)F)c1ccccc1.
What is the InChIKey of propan-2-yl 3-methyl-2-[N-(2,2,2-trifluoroethyl)anilino]butanoate?
The InChIKey is ZTXHCDQVQCYQPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F3NO2/c1-11(2)14(15(21)22-12(3)4)20(10-16(17,18)19)13-8-6-5-7-9-13/h5-9,11-12,14H,10H2,1-4H3.
What are the key properties of propan-2-yl 3-methyl-2-[N-(2,2,2-trifluoroethyl)anilino]butanoate?
propan-2-yl 3-methyl-2-[N-(2,2,2-trifluoroethyl)anilino]butanoate has a molecular weight of 317.35 g/mol, XLogP of 4.03, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-methyl-2-[N-(2,2,2-trifluoroethyl)anilino]butanoate is sourced from PubChem (CID 158892955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).