C34H52FeP2 — CID 158893056
cyclopenta-1,3-diene;ditert-butyl-[[3-cyclohexa-2,4-dien-1-ylidene-5-(ditert-butylphosphanylmethyl)cyclopenta-1,4-dien-1-yl]methyl]phosphane;iron(2+) (PubChem CID 158893056) has the molecular formula C34H52FeP2 and a molecular weight of 578.58 g/mol. Its IUPAC name is cyclopenta-1,3-diene;ditert-butyl-[[3-cyclohexa-2,4-dien-1-ylidene-5-(ditert-butylphosphanylmethyl)cyclopenta-1,4-dien-1-yl]methyl]phosphane;iron(2+).
| Compound Name | cyclopenta-1,3-diene;ditert-butyl-[[3-cyclohexa-2,4-dien-1-ylidene-5-(ditert-butylphosphanylmethyl)cyclopenta-1,4-dien-1-yl]methyl]phosphane;iron(2+) |
|---|---|
| PubChem CID | 158893056 |
| Molecular Formula | C34H52FeP2 |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | cyclopenta-1,3-diene;ditert-butyl-[[3-cyclohexa-2,4-dien-1-ylidene-5-(ditert-butylphosphanylmethyl)cyclopenta-1,4-dien-1-yl]methyl]phosphane;iron(2+) |
| SMILES | CC(C)(C)P(CC1=CC(=C2C=CC=C[CH-]2)C=C1CP(C(C)(C)C)C(C)(C)C)C(C)(C)C.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C29H47P2.C5H5.Fe/c1-26(2,3)30(27(4,5)6)20-24-18-23(22-16-14-13-15-17-22)19-25(24)21-31(28(7,8)9)29(10,11)12;1-2-4-5-3-1;/h13-19H,20-21H2,1-12H3;1-5H;/q2*-1;+2 |
| InChIKey | JEMBWYYXEQDZIZ-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|