C15H24O — CID 158894608
1-cyclopenta-2,4-dien-1-ylidenedecan-1-ol (PubChem CID 158894608) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylidenedecan-1-ol.
| Compound Name | 1-cyclopenta-2,4-dien-1-ylidenedecan-1-ol |
|---|---|
| PubChem CID | 158894608 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylidenedecan-1-ol |
| SMILES | CCCCCCCCCC(O)=C1C=CC=C1 |
| InChI | InChI=1S/C15H24O/c1-2-3-4-5-6-7-8-13-15(16)14-11-9-10-12-14/h9-12,16H,2-8,13H2,1H3 |
| InChIKey | DWJFEDACJUYPJZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|