About 2-(2-aminopropan-2-yldiazenyl)propan-2-amine;chloro hypochlorite
2-(2-aminopropan-2-yldiazenyl)propan-2-amine;chloro hypochlorite (PubChem CID 158894978) has the molecular formula C6H16Cl2N4O
and a molecular weight of 231.13 g/mol. Its IUPAC name is 2-(2-aminopropan-2-yldiazenyl)propan-2-amine;chloro hypochlorite.
Molecular Properties
| Compound Name | 2-(2-aminopropan-2-yldiazenyl)propan-2-amine;chloro hypochlorite |
| PubChem CID | 158894978 |
| Molecular Formula | C6H16Cl2N4O |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-(2-aminopropan-2-yldiazenyl)propan-2-amine;chloro hypochlorite |
| SMILES | CC(C)(N)N=NC(C)(C)N.ClOCl |
| InChI | InChI=1S/C6H16N4.Cl2O/c1-5(2,7)9-10-6(3,4)8;1-3-2/h7-8H2,1-4H3; |
| InChIKey | JESKQFOQSFGMOS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminopropan-2-yldiazenyl)propan-2-amine;chloro hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminopropan-2-yldiazenyl)propan-2-amine;chloro hypochlorite?
The IUPAC name of 2-(2-aminopropan-2-yldiazenyl)propan-2-amine;chloro hypochlorite (CID 158894978) is 2-(2-aminopropan-2-yldiazenyl)propan-2-amine;chloro hypochlorite.
What is the SMILES notation for 2-(2-aminopropan-2-yldiazenyl)propan-2-amine;chloro hypochlorite?
The canonical SMILES for 2-(2-aminopropan-2-yldiazenyl)propan-2-amine;chloro hypochlorite is CC(C)(N)N=NC(C)(C)N.ClOCl.
What is the InChIKey of 2-(2-aminopropan-2-yldiazenyl)propan-2-amine;chloro hypochlorite?
The InChIKey is JESKQFOQSFGMOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N4.Cl2O/c1-5(2,7)9-10-6(3,4)8;1-3-2/h7-8H2,1-4H3;.
What are the key properties of 2-(2-aminopropan-2-yldiazenyl)propan-2-amine;chloro hypochlorite?
2-(2-aminopropan-2-yldiazenyl)propan-2-amine;chloro hypochlorite has a molecular weight of 231.13 g/mol, XLogP of 2.14, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminopropan-2-yldiazenyl)propan-2-amine;chloro hypochlorite is sourced from PubChem (CID 158894978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).