C39H46Cl2O6S2 — CID 158897232
3-(6-chloro-2,3,4-trimethylphenyl)-4-hydroxy-5,5-dimethylthiophen-2-one;methyl 2-(6-chloro-2,3,4-trimethylphenyl)-4-[(4-methoxyphenyl)methylsulfanyl]-4-methyl-3-oxopentanoate (PubChem CID 158897232) has the molecular formula C39H46Cl2O6S2 and a molecular weight of 745.83 g/mol. Its IUPAC name is 3-(6-chloro-2,3,4-trimethylphenyl)-4-hydroxy-5,5-dimethylthiophen-2-one;methyl 2-(6-chloro-2,3,4-trimethylphenyl)-4-[(4-methoxyphenyl)methylsulfanyl]-4-methyl-3-oxopentanoate.
| Compound Name | 3-(6-chloro-2,3,4-trimethylphenyl)-4-hydroxy-5,5-dimethylthiophen-2-one;methyl 2-(6-chloro-2,3,4-trimethylphenyl)-4-[(4-methoxyphenyl)methylsulfanyl]-4-methyl-3-oxopentanoate |
|---|---|
| PubChem CID | 158897232 |
| Molecular Formula | C39H46Cl2O6S2 |
| Molecular Weight | 745.83 g/mol |
| Exact Mass | 744.21 |
| IUPAC Name | 3-(6-chloro-2,3,4-trimethylphenyl)-4-hydroxy-5,5-dimethylthiophen-2-one;methyl 2-(6-chloro-2,3,4-trimethylphenyl)-4-[(4-methoxyphenyl)methylsulfanyl]-4-methyl-3-oxopentanoate |
| SMILES | COC(=O)C(C(=O)C(C)(C)SCc1ccc(OC)cc1)c1c(Cl)cc(C)c(C)c1C.Cc1cc(Cl)c(C2=C(O)C(C)(C)SC2=O)c(C)c1C |
| InChI | InChI=1S/C24H29ClO4S.C15H17ClO2S/c1-14-12-19(25)20(16(3)15(14)2)21(23(27)29-7)22(26)24(4,5)30-13-17-8-10-18(28-6)11-9-17;1-7-6-10(16)11(9(3)8(7)2)12-13(17)15(4,5)19-14(12)18/h8-12,21H,13H2,1-7H3;6,17H,1-5H3 |
| InChIKey | JEZGGFSZDOHEQA-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.83 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|