C15H12Cl3FN4O — CID 158899158
4,7-dichloro-1-(4-chloro-2-propan-2-yl-3-pyridinyl)-6-fluoro-3,4-dihydropyrido[2,3-d]pyrimidin-2-one (PubChem CID 158899158) has the molecular formula C15H12Cl3FN4O and a molecular weight of 389.65 g/mol. Its IUPAC name is 4,7-dichloro-1-(4-chloro-2-propan-2-yl-3-pyridinyl)-6-fluoro-3,4-dihydropyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 4,7-dichloro-1-(4-chloro-2-propan-2-yl-3-pyridinyl)-6-fluoro-3,4-dihydropyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 158899158 |
| Molecular Formula | C15H12Cl3FN4O |
| Molecular Weight | 389.65 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 4,7-dichloro-1-(4-chloro-2-propan-2-yl-3-pyridinyl)-6-fluoro-3,4-dihydropyrido[2,3-d]pyrimidin-2-one |
| SMILES | CC(C)c1nccc(Cl)c1N1C(=O)NC(Cl)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C15H12Cl3FN4O/c1-6(2)10-11(8(16)3-4-20-10)23-14-7(12(17)22-15(23)24)5-9(19)13(18)21-14/h3-6,12H,1-2H3,(H,22,24) |
| InChIKey | GQUVLHUBQVBJCE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.65 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|