C28H13F4I5O11-2 — CID 158900312
2,2-difluoro-3-(furan-2-yl)-3-(2-hydroxy-3,5-diiodobenzoyl)oxypropanoate;2,2-difluoro-3-(furan-2-yl)-3-(2,3,5-triiodobenzoyl)oxypropanoate (PubChem CID 158900312) has the molecular formula C28H13F4I5O11-2 and a molecular weight of 1235.91 g/mol. Its IUPAC name is 2,2-difluoro-3-(furan-2-yl)-3-(2-hydroxy-3,5-diiodobenzoyl)oxypropanoate;2,2-difluoro-3-(furan-2-yl)-3-(2,3,5-triiodobenzoyl)oxypropanoate.
| Compound Name | 2,2-difluoro-3-(furan-2-yl)-3-(2-hydroxy-3,5-diiodobenzoyl)oxypropanoate;2,2-difluoro-3-(furan-2-yl)-3-(2,3,5-triiodobenzoyl)oxypropanoate |
|---|---|
| PubChem CID | 158900312 |
| Molecular Formula | C28H13F4I5O11-2 |
| Molecular Weight | 1235.91 g/mol |
| Exact Mass | 1235.56 |
| IUPAC Name | 2,2-difluoro-3-(furan-2-yl)-3-(2-hydroxy-3,5-diiodobenzoyl)oxypropanoate;2,2-difluoro-3-(furan-2-yl)-3-(2,3,5-triiodobenzoyl)oxypropanoate |
| SMILES | O=C(OC(c1ccco1)C(F)(F)C(=O)[O-])c1cc(I)cc(I)c1I.O=C(OC(c1ccco1)C(F)(F)C(=O)[O-])c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C14H7F2I3O5.C14H8F2I2O6/c2*15-14(16,13(21)22)11(9-2-1-3-23-9)24-12(20)7-4-6(17)5-8(18)10(7)19/h1-5,11H,(H,21,22);1-5,11,19H,(H,21,22)/p-2 |
| InChIKey | JFIWDTYQGIWJHH-UHFFFAOYSA-L |
| XLogP | 5.85 |
| TPSA | 179.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1235.91 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|