C39H74O6 — CID 158902601
(Z)-20,21-dihydroxyhenicos-9-enoic acid;(Z)-octadec-9-enoic acid (PubChem CID 158902601) has the molecular formula C39H74O6 and a molecular weight of 639.02 g/mol. Its IUPAC name is (Z)-20,21-dihydroxyhenicos-9-enoic acid;(Z)-octadec-9-enoic acid.
| Compound Name | (Z)-20,21-dihydroxyhenicos-9-enoic acid;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 158902601 |
| Molecular Formula | C39H74O6 |
| Molecular Weight | 639.02 g/mol |
| Exact Mass | 638.55 |
| IUPAC Name | (Z)-20,21-dihydroxyhenicos-9-enoic acid;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.O=C(O)CCCCCCC/C=C\CCCCCCCCCC(O)CO |
| InChI | InChI=1S/C21H40O4.C18H34O2/c22-19-20(23)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-21(24)25;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2,4,20,22-23H,1,3,5-19H2,(H,24,25);9-10H,2-8,11-17H2,1H3,(H,19,20)/b4-2-;10-9- |
| InChIKey | JFQDBMNFOIZUTO-ASUHIHGASA-N |
| XLogP | 11.33 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.02 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|