C30H42N5S+ — CID 158903130
N'-[3-(dimethylamino)propyl]-N'-[4-[(3,5-dimethyl-1,3-benzothiazol-2-ylidene)methyl]-1-methylquinolin-1-ium-2-yl]-N,N-dimethylpropane-1,3-diamine (PubChem CID 158903130) has the molecular formula C30H42N5S+ and a molecular weight of 504.77 g/mol. Its IUPAC name is N'-[3-(dimethylamino)propyl]-N'-[4-[(3,5-dimethyl-1,3-benzothiazol-2-ylidene)methyl]-1-methylquinolin-1-ium-2-yl]-N,N-dimethylpropane-1,3-diamine.
| Compound Name | N'-[3-(dimethylamino)propyl]-N'-[4-[(3,5-dimethyl-1,3-benzothiazol-2-ylidene)methyl]-1-methylquinolin-1-ium-2-yl]-N,N-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 158903130 |
| Molecular Formula | C30H42N5S+ |
| Molecular Weight | 504.77 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | N'-[3-(dimethylamino)propyl]-N'-[4-[(3,5-dimethyl-1,3-benzothiazol-2-ylidene)methyl]-1-methylquinolin-1-ium-2-yl]-N,N-dimethylpropane-1,3-diamine |
| SMILES | Cc1ccc2c(c1)N(C)C(=Cc1cc(N(CCCN(C)C)CCCN(C)C)[n+](C)c3ccccc13)S2 |
| InChI | InChI=1S/C30H42N5S/c1-23-14-15-28-27(20-23)34(7)30(36-28)22-24-21-29(33(6)26-13-9-8-12-25(24)26)35(18-10-16-31(2)3)19-11-17-32(4)5/h8-9,12-15,20-22H,10-11,16-19H2,1-7H3/q+1 |
| InChIKey | JFRVLQPGMHDBRL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 16.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.77 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|