C14H17N5O3S — CID 15890365
1-(4-methoxy-6-methylpyrimidin-2-yl)-2-(4-methylphenyl)sulfonylguanidine (PubChem CID 15890365) has the molecular formula C14H17N5O3S and a molecular weight of 335.39 g/mol. Its IUPAC name is 1-(4-methoxy-6-methylpyrimidin-2-yl)-2-(4-methylphenyl)sulfonylguanidine.
| Compound Name | 1-(4-methoxy-6-methylpyrimidin-2-yl)-2-(4-methylphenyl)sulfonylguanidine |
|---|---|
| PubChem CID | 15890365 |
| Molecular Formula | C14H17N5O3S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-(4-methoxy-6-methylpyrimidin-2-yl)-2-(4-methylphenyl)sulfonylguanidine |
| SMILES | COc1cc(C)nc(N/C(N)=N/S(=O)(=O)c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C14H17N5O3S/c1-9-4-6-11(7-5-9)23(20,21)19-13(15)18-14-16-10(2)8-12(17-14)22-3/h4-8H,1-3H3,(H3,15,16,17,18,19) |
| InChIKey | IMYNXLISKBVSNI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|