C14H25ClN6O2 — CID 15890380
(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-trimethylazanium chloride (PubChem CID 15890380) has the molecular formula C14H25ClN6O2 and a molecular weight of 344.85 g/mol. Its IUPAC name is (4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-trimethylazanium chloride.
| Compound Name | (4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-trimethylazanium chloride |
|---|---|
| PubChem CID | 15890380 |
| Molecular Formula | C14H25ClN6O2 |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-trimethylazanium chloride |
| SMILES | C[N+](C)(C)c1nc(N2CCOCC2)nc(N2CCOCC2)n1.[Cl-] |
| InChI | InChI=1S/C14H25N6O2.ClH/c1-20(2,3)14-16-12(18-4-8-21-9-5-18)15-13(17-14)19-6-10-22-11-7-19;/h4-11H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | UIZQKGTZNNWRGF-UHFFFAOYSA-M |
| XLogP | -3.25 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|