C33H28N4O3S — CID 158905125
2-[4-[(E)-2-[5-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]thiophen-2-yl]ethenyl]-3-isocyano-5-methyl-5-phenylfuran-2-ylidene]propanedinitrile (PubChem CID 158905125) has the molecular formula C33H28N4O3S and a molecular weight of 560.68 g/mol. Its IUPAC name is 2-[4-[(E)-2-[5-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]thiophen-2-yl]ethenyl]-3-isocyano-5-methyl-5-phenylfuran-2-ylidene]propanedinitrile.
| Compound Name | 2-[4-[(E)-2-[5-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]thiophen-2-yl]ethenyl]-3-isocyano-5-methyl-5-phenylfuran-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 158905125 |
| Molecular Formula | C33H28N4O3S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | 2-[4-[(E)-2-[5-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]thiophen-2-yl]ethenyl]-3-isocyano-5-methyl-5-phenylfuran-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C1=C(/C=C/c2ccc(/C=C/c3ccc(N(CCO)CCO)cc3)s2)C(C)(c2ccccc2)OC1=C(C#N)C#N |
| InChI | InChI=1S/C33H28N4O3S/c1-33(26-6-4-3-5-7-26)30(31(36-2)32(40-33)25(22-34)23-35)17-16-29-15-14-28(41-29)13-10-24-8-11-27(12-9-24)37(18-20-38)19-21-39/h3-17,38-39H,18-21H2,1H3/b13-10+,17-16+ |
| InChIKey | JFYHKPCHIPQUQD-VTRAWOOYSA-N |
| XLogP | 6.14 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|