C21H22N5+ — CID 158905192
5-(1,3-dimethylimidazol-1-ium-2-yl)-3,4,7-trimethylbenzimidazolo[1,2-a]benzimidazole (PubChem CID 158905192) has the molecular formula C21H22N5+ and a molecular weight of 344.44 g/mol. Its IUPAC name is 5-(1,3-dimethylimidazol-1-ium-2-yl)-3,4,7-trimethylbenzimidazolo[1,2-a]benzimidazole.
| Compound Name | 5-(1,3-dimethylimidazol-1-ium-2-yl)-3,4,7-trimethylbenzimidazolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 158905192 |
| Molecular Formula | C21H22N5+ |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 5-(1,3-dimethylimidazol-1-ium-2-yl)-3,4,7-trimethylbenzimidazolo[1,2-a]benzimidazole |
| SMILES | Cc1ccc2c(c1C)n(-c1n(C)cc[n+]1C)c1nc3c(C)cccc3n21 |
| InChI | InChI=1S/C21H22N5/c1-13-9-10-17-19(15(13)3)26(21-23(4)11-12-24(21)5)20-22-18-14(2)7-6-8-16(18)25(17)20/h6-12H,1-5H3/q+1 |
| InChIKey | HYXFSODFQPZZNZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 31.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|