C14H16N2O3S2 — CID 158905232
8-hydroxy-1-[2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]octane-1,7-dione (PubChem CID 158905232) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 8-hydroxy-1-[2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]octane-1,7-dione.
| Compound Name | 8-hydroxy-1-[2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]octane-1,7-dione |
|---|---|
| PubChem CID | 158905232 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 8-hydroxy-1-[2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]octane-1,7-dione |
| SMILES | O=C(CO)CCCCCC(=O)c1csc(-c2nccs2)n1 |
| InChI | InChI=1S/C14H16N2O3S2/c17-8-10(18)4-2-1-3-5-12(19)11-9-21-14(16-11)13-15-6-7-20-13/h6-7,9,17H,1-5,8H2 |
| InChIKey | JFYPLKNKDYIWET-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|