About ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate
ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate (PubChem CID 15890569) has the molecular formula C12H12Br4O3
and a molecular weight of 523.84 g/mol. Its IUPAC name is ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate.
Molecular Properties
| Compound Name | ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate |
| PubChem CID | 15890569 |
| Molecular Formula | C12H12Br4O3 |
| Molecular Weight | 523.84 g/mol |
| Exact Mass | 519.75 |
| IUPAC Name | ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)CCc1c(Br)c(Br)c(OC)c(Br)c1Br |
| InChI | InChI=1S/C12H12Br4O3/c1-3-19-7(17)5-4-6-8(13)10(15)12(18-2)11(16)9(6)14/h3-5H2,1-2H3 |
| InChIKey | PPQVYCHLOMCZOF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.84 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate?
The IUPAC name of ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate (CID 15890569) is ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate.
What is the SMILES notation for ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate?
The canonical SMILES for ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate is CCOC(=O)CCc1c(Br)c(Br)c(OC)c(Br)c1Br.
What is the InChIKey of ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate?
The InChIKey is PPQVYCHLOMCZOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Br4O3/c1-3-19-7(17)5-4-6-8(13)10(15)12(18-2)11(16)9(6)14/h3-5H2,1-2H3.
What are the key properties of ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate?
ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate has a molecular weight of 523.84 g/mol, XLogP of 5.24, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate is sourced from PubChem (CID 15890569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).