C12H12Br4O3 — CID 15890569
ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate (PubChem CID 15890569) has the molecular formula C12H12Br4O3 and a molecular weight of 523.84 g/mol. Its IUPAC name is ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate.
| Compound Name | ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 15890569 |
| Molecular Formula | C12H12Br4O3 |
| Molecular Weight | 523.84 g/mol |
| Exact Mass | 519.75 |
| IUPAC Name | ethyl 3-(2,3,5,6-tetrabromo-4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)CCc1c(Br)c(Br)c(OC)c(Br)c1Br |
| InChI | InChI=1S/C12H12Br4O3/c1-3-19-7(17)5-4-6-8(13)10(15)12(18-2)11(16)9(6)14/h3-5H2,1-2H3 |
| InChIKey | PPQVYCHLOMCZOF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.84 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|